C16H30O6Si — CID 164574889
(2R,3R,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-but-3-ynoxyoxane-3,4,5-triol (PubChem CID 164574889) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-but-3-ynoxyoxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-but-3-ynoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 164574889 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-but-3-ynoxyoxane-3,4,5-triol |
| SMILES | C#CCCO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H30O6Si/c1-7-8-9-20-15-14(19)13(18)12(17)11(22-15)10-21-23(5,6)16(2,3)4/h1,11-15,17-19H,8-10H2,2-6H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | BYNAWCUQEIKKGO-GZBLMMOJSA-N |
| XLogP | 0.86 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|