C18H24N6O2 — CID 164575113
8-[[2-[(4R)-4-amino-5-methoxypentoxy]phenyl]methyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 164575113) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 8-[[2-[(4R)-4-amino-5-methoxypentoxy]phenyl]methyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[[2-[(4R)-4-amino-5-methoxypentoxy]phenyl]methyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 164575113 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 8-[[2-[(4R)-4-amino-5-methoxypentoxy]phenyl]methyl]pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COC[C@H](N)CCCOc1ccccc1Cc1cnn2c(N)ncnc12 |
| InChI | InChI=1S/C18H24N6O2/c1-25-11-15(19)6-4-8-26-16-7-3-2-5-13(16)9-14-10-23-24-17(14)21-12-22-18(24)20/h2-3,5,7,10,12,15H,4,6,8-9,11,19H2,1H3,(H2,20,21,22)/t15-/m1/s1 |
| InChIKey | RSFMBHXELDMQLU-OAHLLOKOSA-N |
| XLogP | 1.43 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|