C17H13F2N5O2 — CID 164575403
1-[(4-amino-2,6-difluorophenyl)methyl]-7-methoxy-3H-imidazo[4,5-c][1,8]naphthyridin-2-one (PubChem CID 164575403) has the molecular formula C17H13F2N5O2 and a molecular weight of 357.32 g/mol. Its IUPAC name is 1-[(4-amino-2,6-difluorophenyl)methyl]-7-methoxy-3H-imidazo[4,5-c][1,8]naphthyridin-2-one.
| Compound Name | 1-[(4-amino-2,6-difluorophenyl)methyl]-7-methoxy-3H-imidazo[4,5-c][1,8]naphthyridin-2-one |
|---|---|
| PubChem CID | 164575403 |
| Molecular Formula | C17H13F2N5O2 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 1-[(4-amino-2,6-difluorophenyl)methyl]-7-methoxy-3H-imidazo[4,5-c][1,8]naphthyridin-2-one |
| SMILES | COc1ccc2c(ncc3[nH]c(=O)n(Cc4c(F)cc(N)cc4F)c32)n1 |
| InChI | InChI=1S/C17H13F2N5O2/c1-26-14-3-2-9-15-13(6-21-16(9)23-14)22-17(25)24(15)7-10-11(18)4-8(20)5-12(10)19/h2-6H,7,20H2,1H3,(H,22,25) |
| InChIKey | DICWFQIPICOIBQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|