C26H42N4O5S — CID 164575504
(2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-(3-methylbutanoylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid (PubChem CID 164575504) has the molecular formula C26H42N4O5S and a molecular weight of 522.71 g/mol. Its IUPAC name is (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-(3-methylbutanoylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid.
| Compound Name | (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-(3-methylbutanoylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid |
|---|---|
| PubChem CID | 164575504 |
| Molecular Formula | C26H42N4O5S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (2S)-2-[[(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-(3-methylbutanoylamino)butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid |
| SMILES | CC(C)CC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)S)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H42N4O5S/c1-13(2)10-17(31)29-20(25(3,4)5)23(34)30-12-15-18(26(15,6)7)19(30)22(33)28-16(24(35)36)11-14-8-9-27-21(14)32/h13-16,18-20H,8-12H2,1-7H3,(H,27,32)(H,28,33)(H,29,31)(H,35,36)/t14-,15-,16-,18-,19-,20+/m0/s1 |
| InChIKey | RDFZXYXIMLUSGH-WKSOIMLMSA-N |
| XLogP | 1.51 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|