About 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine
2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine (PubChem CID 164575618) has the molecular formula C15H13FN6
and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine.
Molecular Properties
| Compound Name | 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine |
| PubChem CID | 164575618 |
| Molecular Formula | C15H13FN6 |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine |
| SMILES | NC(N)=Nc1nc(-c2ccc(F)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C15H13FN6/c16-11-8-6-10(7-9-11)13-19-15(20-14(17)18)22(21-13)12-4-2-1-3-5-12/h1-9H,(H4,17,18,19,20,21) |
| InChIKey | RSULJDHLEWGFRB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine?
The IUPAC name of 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine (CID 164575618) is 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine.
What is the SMILES notation for 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine?
The canonical SMILES for 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine is NC(N)=Nc1nc(-c2ccc(F)cc2)nn1-c1ccccc1.
What is the InChIKey of 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine?
The InChIKey is RSULJDHLEWGFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FN6/c16-11-8-6-10(7-9-11)13-19-15(20-14(17)18)22(21-13)12-4-2-1-3-5-12/h1-9H,(H4,17,18,19,20,21).
What are the key properties of 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine?
2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine has a molecular weight of 296.31 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-fluorophenyl)-2-phenyl-1,2,4-triazol-3-yl]guanidine is sourced from PubChem (CID 164575618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).