About (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine
(5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine (PubChem CID 164576108) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine.
Molecular Properties
| Compound Name | (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine |
| PubChem CID | 164576108 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine |
| SMILES | C1=N\CNCOc2ccccc2/1 |
| InChI | InChI=1S/C9H10N2O/c1-2-4-9-8(3-1)5-10-6-11-7-12-9/h1-5,11H,6-7H2/b10-5- |
| InChIKey | KTIYUFCZXAXTJY-YHYXMXQVSA-N |
| XLogP | 1.00 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine?
The IUPAC name of (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine (CID 164576108) is (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine.
What is the SMILES notation for (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine?
The canonical SMILES for (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine is C1=N\CNCOc2ccccc2/1.
What is the InChIKey of (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine?
The InChIKey is KTIYUFCZXAXTJY-YHYXMXQVSA-N. The full InChI is InChI=1S/C9H10N2O/c1-2-4-9-8(3-1)5-10-6-11-7-12-9/h1-5,11H,6-7H2/b10-5-.
What are the key properties of (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine?
(5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine has a molecular weight of 162.19 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-3,4-dihydro-2H-1,3,5-benzoxadiazocine is sourced from PubChem (CID 164576108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).