About [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate
[1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate (PubChem CID 164576258) has the molecular formula C21H29N3O2
and a molecular weight of 355.48 g/mol. Its IUPAC name is [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate.
Molecular Properties
| Compound Name | [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate |
| PubChem CID | 164576258 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCc1cn(-c2ccc(C)cc2)nn1 |
| InChI | InChI=1S/C21H29N3O2/c1-3-4-5-6-7-8-9-10-11-21(25)26-17-19-16-24(23-22-19)20-14-12-18(2)13-15-20/h3,12-16H,1,4-11,17H2,2H3 |
| InChIKey | TWJDYLJDPNGSRI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate?
The IUPAC name of [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate (CID 164576258) is [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate.
What is the SMILES notation for [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate?
The canonical SMILES for [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate is C=CCCCCCCCCC(=O)OCc1cn(-c2ccc(C)cc2)nn1.
What is the InChIKey of [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate?
The InChIKey is TWJDYLJDPNGSRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29N3O2/c1-3-4-5-6-7-8-9-10-11-21(25)26-17-19-16-24(23-22-19)20-14-12-18(2)13-15-20/h3,12-16H,1,4-11,17H2,2H3.
What are the key properties of [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate?
[1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate has a molecular weight of 355.48 g/mol, XLogP of 4.93, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methylphenyl)triazol-4-yl]methyl undec-10-enoate is sourced from PubChem (CID 164576258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).