C22H21N3O3 — CID 164576309
11-(3,4-dihydroxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-pyrazolo[4,5-a]acridin-10-one (PubChem CID 164576309) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 11-(3,4-dihydroxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-pyrazolo[4,5-a]acridin-10-one.
| Compound Name | 11-(3,4-dihydroxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-pyrazolo[4,5-a]acridin-10-one |
|---|---|
| PubChem CID | 164576309 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 11-(3,4-dihydroxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydro-3H-pyrazolo[4,5-a]acridin-10-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccc3[nH]ncc3c1C2c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-22(2)8-15-21(18(28)9-22)19(11-3-6-16(26)17(27)7-11)20-12-10-23-25-13(12)4-5-14(20)24-15/h3-7,10,19,24,26-27H,8-9H2,1-2H3,(H,23,25) |
| InChIKey | ROYBFXUCKBLIDD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|