C17H26ClNO3 — CID 164576692
ethyl 3-[2-methyl-4-(pyrrolidin-3-ylmethoxy)phenyl]propanoate;hydrochloride (PubChem CID 164576692) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is ethyl 3-[2-methyl-4-(pyrrolidin-3-ylmethoxy)phenyl]propanoate;hydrochloride.
| Compound Name | ethyl 3-[2-methyl-4-(pyrrolidin-3-ylmethoxy)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 164576692 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | ethyl 3-[2-methyl-4-(pyrrolidin-3-ylmethoxy)phenyl]propanoate;hydrochloride |
| SMILES | CCOC(=O)CCc1ccc(OCC2CCNC2)cc1C.Cl |
| InChI | InChI=1S/C17H25NO3.ClH/c1-3-20-17(19)7-5-15-4-6-16(10-13(15)2)21-12-14-8-9-18-11-14;/h4,6,10,14,18H,3,5,7-9,11-12H2,1-2H3;1H |
| InChIKey | HACJCIHGAFHQQR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |