C21H15N5O3 — CID 164576832
12-(4-methoxyphenyl)-8-methyl-5-phenyl-11-oxa-3,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one (PubChem CID 164576832) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is 12-(4-methoxyphenyl)-8-methyl-5-phenyl-11-oxa-3,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one.
| Compound Name | 12-(4-methoxyphenyl)-8-methyl-5-phenyl-11-oxa-3,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 164576832 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 12-(4-methoxyphenyl)-8-methyl-5-phenyl-11-oxa-3,4,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-10-one |
| SMILES | COc1ccc(-c2nc3c(c(C)nc4c3nnn4-c3ccccc3)c(=O)o2)cc1 |
| InChI | InChI=1S/C21H15N5O3/c1-12-16-17(18-19(22-12)26(25-24-18)14-6-4-3-5-7-14)23-20(29-21(16)27)13-8-10-15(28-2)11-9-13/h3-11H,1-2H3 |
| InChIKey | VPVRKQOGQTYBFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |