C16H20N4 — CID 164576856
N-cyclohexyl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine (PubChem CID 164576856) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-cyclohexyl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine.
| Compound Name | N-cyclohexyl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine |
|---|---|
| PubChem CID | 164576856 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-cyclohexyl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine |
| SMILES | c1cc2n(c1)CCc1cnc(NC3CCCCC3)nc1-2 |
| InChI | InChI=1S/C16H20N4/c1-2-5-13(6-3-1)18-16-17-11-12-8-10-20-9-4-7-14(20)15(12)19-16/h4,7,9,11,13H,1-3,5-6,8,10H2,(H,17,18,19) |
| InChIKey | KBEMSBYREVSROE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |