About 3-(propan-2-yloxymethyl)-1,3-oxazolidine
3-(propan-2-yloxymethyl)-1,3-oxazolidine (PubChem CID 164576895) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-(propan-2-yloxymethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 3-(propan-2-yloxymethyl)-1,3-oxazolidine |
| PubChem CID | 164576895 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 3-(propan-2-yloxymethyl)-1,3-oxazolidine |
| SMILES | CC(C)OCN1CCOC1 |
| InChI | InChI=1S/C7H15NO2/c1-7(2)10-6-8-3-4-9-5-8/h7H,3-6H2,1-2H3 |
| InChIKey | ZUNLZVKAQFHVJX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(propan-2-yloxymethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propan-2-yloxymethyl)-1,3-oxazolidine?
The IUPAC name of 3-(propan-2-yloxymethyl)-1,3-oxazolidine (CID 164576895) is 3-(propan-2-yloxymethyl)-1,3-oxazolidine.
What is the SMILES notation for 3-(propan-2-yloxymethyl)-1,3-oxazolidine?
The canonical SMILES for 3-(propan-2-yloxymethyl)-1,3-oxazolidine is CC(C)OCN1CCOC1.
What is the InChIKey of 3-(propan-2-yloxymethyl)-1,3-oxazolidine?
The InChIKey is ZUNLZVKAQFHVJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-7(2)10-6-8-3-4-9-5-8/h7H,3-6H2,1-2H3.
What are the key properties of 3-(propan-2-yloxymethyl)-1,3-oxazolidine?
3-(propan-2-yloxymethyl)-1,3-oxazolidine has a molecular weight of 145.20 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propan-2-yloxymethyl)-1,3-oxazolidine is sourced from PubChem (CID 164576895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).