About 3H-dithiolo[3,4-b][1,4]dithiin-6-one
3H-dithiolo[3,4-b][1,4]dithiin-6-one (PubChem CID 164576899) has the molecular formula C5H4OS4
and a molecular weight of 208.35 g/mol. Its IUPAC name is 3H-dithiolo[3,4-b][1,4]dithiin-6-one.
Molecular Properties
| Compound Name | 3H-dithiolo[3,4-b][1,4]dithiin-6-one |
| PubChem CID | 164576899 |
| Molecular Formula | C5H4OS4 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 207.91 |
| IUPAC Name | 3H-dithiolo[3,4-b][1,4]dithiin-6-one |
| SMILES | O=C1CSC2=C(SSC2)S1 |
| InChI | InChI=1S/C5H4OS4/c6-4-2-7-3-1-8-10-5(3)9-4/h1-2H2 |
| InChIKey | YDTJKEPKAFERDB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3H-dithiolo[3,4-b][1,4]dithiin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dithiolo[3,4-b][1,4]dithiin-6-one?
The IUPAC name of 3H-dithiolo[3,4-b][1,4]dithiin-6-one (CID 164576899) is 3H-dithiolo[3,4-b][1,4]dithiin-6-one.
What is the SMILES notation for 3H-dithiolo[3,4-b][1,4]dithiin-6-one?
The canonical SMILES for 3H-dithiolo[3,4-b][1,4]dithiin-6-one is O=C1CSC2=C(SSC2)S1.
What is the InChIKey of 3H-dithiolo[3,4-b][1,4]dithiin-6-one?
The InChIKey is YDTJKEPKAFERDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4OS4/c6-4-2-7-3-1-8-10-5(3)9-4/h1-2H2.
What are the key properties of 3H-dithiolo[3,4-b][1,4]dithiin-6-one?
3H-dithiolo[3,4-b][1,4]dithiin-6-one has a molecular weight of 208.35 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dithiolo[3,4-b][1,4]dithiin-6-one is sourced from PubChem (CID 164576899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).