C16H14N2 — CID 164576957
(1Z,9Z,13Z,15Z,17Z)-8,12-diazatricyclo[10.6.0.02,7]octadeca-1,3,5,7,9,13,15,17-octaene (PubChem CID 164576957) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (1Z,9Z,13Z,15Z,17Z)-8,12-diazatricyclo[10.6.0.02,7]octadeca-1,3,5,7,9,13,15,17-octaene.
| Compound Name | (1Z,9Z,13Z,15Z,17Z)-8,12-diazatricyclo[10.6.0.02,7]octadeca-1,3,5,7,9,13,15,17-octaene |
|---|---|
| PubChem CID | 164576957 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (1Z,9Z,13Z,15Z,17Z)-8,12-diazatricyclo[10.6.0.02,7]octadeca-1,3,5,7,9,13,15,17-octaene |
| SMILES | C1=C\C=C/N2C/C=C\N=c3\cccc\c3=C2\C=C/1 |
| InChI | InChI=1S/C16H14N2/c1-2-6-12-18-13-7-11-17-15-9-5-4-8-14(15)16(18)10-3-1/h1-12H,13H2/b2-1-,10-3-,11-7-,12-6-,16-14-,17-15- |
| InChIKey | JIKHIWLYYZIBBR-PZTOFOQKSA-N |
| XLogP | 1.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |