C10H2F8O2 — CID 164576966
2,2,3,3,4,5,6,7-octafluoro-1H-indene-1-carboxylic acid (PubChem CID 164576966) has the molecular formula C10H2F8O2 and a molecular weight of 306.11 g/mol. Its IUPAC name is 2,2,3,3,4,5,6,7-octafluoro-1H-indene-1-carboxylic acid.
| Compound Name | 2,2,3,3,4,5,6,7-octafluoro-1H-indene-1-carboxylic acid |
|---|---|
| PubChem CID | 164576966 |
| Molecular Formula | C10H2F8O2 |
| Molecular Weight | 306.11 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2,2,3,3,4,5,6,7-octafluoro-1H-indene-1-carboxylic acid |
| SMILES | O=C(O)C1c2c(F)c(F)c(F)c(F)c2C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H2F8O2/c11-4-1-2(5(12)7(14)6(4)13)9(15,16)10(17,18)3(1)8(19)20/h3H,(H,19,20) |
| InChIKey | BUSBUCZGGZEDRV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.11 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|