C20H25F2N5O2 — CID 164577661
6-[4-[1-[(1S)-2,2-difluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 164577661) has the molecular formula C20H25F2N5O2 and a molecular weight of 405.45 g/mol. Its IUPAC name is 6-[4-[1-[(1S)-2,2-difluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[1-[(1S)-2,2-difluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 164577661 |
| Molecular Formula | C20H25F2N5O2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 6-[4-[1-[(1S)-2,2-difluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCCCc3nnnn3[C@H]3CCCCC3(F)F)ccc2N1 |
| InChI | InChI=1S/C20H25F2N5O2/c21-20(22)11-3-1-5-17(20)27-18(24-25-26-27)6-2-4-12-29-15-8-9-16-14(13-15)7-10-19(28)23-16/h8-9,13,17H,1-7,10-12H2,(H,23,28)/t17-/m0/s1 |
| InChIKey | RSXIZNPMDXGFOT-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|