C20H26FN5O2 — CID 164577662
6-[4-[1-[(1S,2S)-2-fluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 164577662) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 6-[4-[1-[(1S,2S)-2-fluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[1-[(1S,2S)-2-fluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 164577662 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 6-[4-[1-[(1S,2S)-2-fluorocyclohexyl]tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(OCCCCc3nnnn3[C@H]3CCCC[C@@H]3F)ccc2N1 |
| InChI | InChI=1S/C20H26FN5O2/c21-16-5-1-2-6-18(16)26-19(23-24-25-26)7-3-4-12-28-15-9-10-17-14(13-15)8-11-20(27)22-17/h9-10,13,16,18H,1-8,11-12H2,(H,22,27)/t16-,18-/m0/s1 |
| InChIKey | AZIRYPMCGTWCHA-WMZOPIPTSA-N |
| XLogP | 3.41 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|