C18H21F2NO2 — CID 164578557
2-methylbutan-2-yl 4,4-difluoro-4-quinolin-5-ylbutanoate (PubChem CID 164578557) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4,4-difluoro-4-quinolin-5-ylbutanoate.
| Compound Name | 2-methylbutan-2-yl 4,4-difluoro-4-quinolin-5-ylbutanoate |
|---|---|
| PubChem CID | 164578557 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-methylbutan-2-yl 4,4-difluoro-4-quinolin-5-ylbutanoate |
| SMILES | CCC(C)(C)OC(=O)CCC(F)(F)c1cccc2ncccc12 |
| InChI | InChI=1S/C18H21F2NO2/c1-4-17(2,3)23-16(22)10-11-18(19,20)14-8-5-9-15-13(14)7-6-12-21-15/h5-9,12H,4,10-11H2,1-3H3 |
| InChIKey | QEYRNGQSXOVDHS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |