C9H5Br2ClF4OS — CID 164578578
1-bromo-4-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2-chloro-3-methylsulfanylbenzene (PubChem CID 164578578) has the molecular formula C9H5Br2ClF4OS and a molecular weight of 432.46 g/mol. Its IUPAC name is 1-bromo-4-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2-chloro-3-methylsulfanylbenzene.
| Compound Name | 1-bromo-4-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2-chloro-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 164578578 |
| Molecular Formula | C9H5Br2ClF4OS |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 429.81 |
| IUPAC Name | 1-bromo-4-(2-bromo-1,1,2,2-tetrafluoroethoxy)-2-chloro-3-methylsulfanylbenzene |
| SMILES | CSc1c(OC(F)(F)C(F)(F)Br)ccc(Br)c1Cl |
| InChI | InChI=1S/C9H5Br2ClF4OS/c1-18-7-5(3-2-4(10)6(7)12)17-9(15,16)8(11,13)14/h2-3H,1H3 |
| InChIKey | BUGWSSMYWIBPSY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|