C25H31N5O2 — CID 164578624
4-[(4R,10bS)-8-[2-(dimethylamino)ethoxy]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-1-methyl-1,8-naphthyridin-2-one (PubChem CID 164578624) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[(4R,10bS)-8-[2-(dimethylamino)ethoxy]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-1-methyl-1,8-naphthyridin-2-one.
| Compound Name | 4-[(4R,10bS)-8-[2-(dimethylamino)ethoxy]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-1-methyl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 164578624 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 4-[(4R,10bS)-8-[2-(dimethylamino)ethoxy]-4-methyl-3,4,6,10b-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]-1-methyl-1,8-naphthyridin-2-one |
| SMILES | C[C@@H]1CN(c2cc(=O)n(C)c3ncccc23)C[C@@H]2c3ccc(OCCN(C)C)cc3CN12 |
| InChI | InChI=1S/C25H31N5O2/c1-17-14-29(22-13-24(31)28(4)25-21(22)6-5-9-26-25)16-23-20-8-7-19(32-11-10-27(2)3)12-18(20)15-30(17)23/h5-9,12-13,17,23H,10-11,14-16H2,1-4H3/t17-,23-/m1/s1 |
| InChIKey | JRJGYNKWYMWAOO-UZUQRXQVSA-N |
| XLogP | 2.64 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |