C18H21N5 — CID 164578646
5-[(4R,7R,8aS)-7-amino-4-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 164578646) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-[(4R,7R,8aS)-7-amino-4-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,7R,8aS)-7-amino-4-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 164578646 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 5-[(4R,7R,8aS)-7-amino-4-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2C[C@@H](N)CN21 |
| InChI | InChI=1S/C18H21N5/c1-12-9-22(11-15-7-14(20)10-23(12)15)17-5-4-13(8-19)18-16(17)3-2-6-21-18/h2-6,12,14-15H,7,9-11,20H2,1H3/t12-,14-,15+/m1/s1 |
| InChIKey | AUIACVWGWZWBQI-YUELXQCFSA-N |
| XLogP | 1.72 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |