C28H36N4O5S — CID 164579095
2-amino-N-[(2R)-1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methoxy]-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-4-oxobut-3-en-2-yl]-2-methylpropanamide (PubChem CID 164579095) has the molecular formula C28H36N4O5S and a molecular weight of 547.73 g/mol. Its IUPAC name is 2-amino-N-[(2R)-1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methoxy]-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-4-oxobut-3-en-2-yl]-2-methylpropanamide.
| Compound Name | 2-amino-N-[(2R)-1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methoxy]-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-4-oxobut-3-en-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 164579095 |
| Molecular Formula | C28H36N4O5S |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 2-amino-N-[(2R)-1-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methoxy]-3-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-4-oxobut-3-en-2-yl]-2-methylpropanamide |
| SMILES | [2H]c1c([2H])c([2H])c(C([2H])([2H])OC[C@H](NC(=O)C(C)(C)N)C(=C=O)N2CCC3(CC2)CN(S(C)(=O)=O)c2ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C28H36N4O5S/c1-27(2,29)26(34)30-23(19-37-18-21-9-5-4-6-10-21)25(17-33)31-15-13-28(14-16-31)20-32(38(3,35)36)24-12-8-7-11-22(24)28/h4-12,23H,13-16,18-20,29H2,1-3H3,(H,30,34)/t23-/m0/s1/i4D,5D,6D,9D,10D,18D2 |
| InChIKey | OBRYXLUOZJGMRC-YUNXYCAVSA-N |
| XLogP | 1.95 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|