C26H27NO2 — CID 164579265
(2R,3S)-N-benzyl-2-(4-methylphenyl)-3-phenylmethoxypent-4-enamide (PubChem CID 164579265) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2R,3S)-N-benzyl-2-(4-methylphenyl)-3-phenylmethoxypent-4-enamide.
| Compound Name | (2R,3S)-N-benzyl-2-(4-methylphenyl)-3-phenylmethoxypent-4-enamide |
|---|---|
| PubChem CID | 164579265 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R,3S)-N-benzyl-2-(4-methylphenyl)-3-phenylmethoxypent-4-enamide |
| SMILES | C=C[C@H](OCc1ccccc1)[C@H](C(=O)NCc1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H27NO2/c1-3-24(29-19-22-12-8-5-9-13-22)25(23-16-14-20(2)15-17-23)26(28)27-18-21-10-6-4-7-11-21/h3-17,24-25H,1,18-19H2,2H3,(H,27,28)/t24-,25+/m0/s1 |
| InChIKey | KHPFUXMVPQSNFS-LOSJGSFVSA-N |
| XLogP | 5.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|