About (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide
(3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 164579782) has the molecular formula C12H14F3NO2
and a molecular weight of 261.24 g/mol. Its IUPAC name is (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide |
| PubChem CID | 164579782 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | CN(C)C(=O)C[C@@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO2/c1-16(2)11(18)7-10(17)8-3-5-9(6-4-8)12(13,14)15/h3-6,10,17H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | IJACSBTYOHTJTQ-SNVBAGLBSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide?
The IUPAC name of (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide (CID 164579782) is (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide.
What is the SMILES notation for (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide?
The canonical SMILES for (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide is CN(C)C(=O)C[C@@H](O)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide?
The InChIKey is IJACSBTYOHTJTQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H14F3NO2/c1-16(2)11(18)7-10(17)8-3-5-9(6-4-8)12(13,14)15/h3-6,10,17H,7H2,1-2H3/t10-/m1/s1.
What are the key properties of (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide?
(3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide has a molecular weight of 261.24 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-N,N-dimethyl-3-[4-(trifluoromethyl)phenyl]propanamide is sourced from PubChem (CID 164579782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).