C19H17F3N4 — CID 164580396
5,12,12-trimethyl-2-(trifluoromethyl)quinolino[2,3-b]quinoxalin-9-amine (PubChem CID 164580396) has the molecular formula C19H17F3N4 and a molecular weight of 358.37 g/mol. Its IUPAC name is 5,12,12-trimethyl-2-(trifluoromethyl)quinolino[2,3-b]quinoxalin-9-amine.
| Compound Name | 5,12,12-trimethyl-2-(trifluoromethyl)quinolino[2,3-b]quinoxalin-9-amine |
|---|---|
| PubChem CID | 164580396 |
| Molecular Formula | C19H17F3N4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5,12,12-trimethyl-2-(trifluoromethyl)quinolino[2,3-b]quinoxalin-9-amine |
| SMILES | CN1c2ccc(C(F)(F)F)cc2C(C)(C)c2nc3cc(N)ccc3nc21 |
| InChI | InChI=1S/C19H17F3N4/c1-18(2)12-8-10(19(20,21)22)4-7-15(12)26(3)17-16(18)24-14-9-11(23)5-6-13(14)25-17/h4-9H,23H2,1-3H3 |
| InChIKey | DMCNICSHKBZFAW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|