About N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride
N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride (PubChem CID 164580535) has the molecular formula C9H21ClN2O4S
and a molecular weight of 288.80 g/mol. Its IUPAC name is N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride |
| PubChem CID | 164580535 |
| Molecular Formula | C9H21ClN2O4S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride |
| SMILES | COCCS(=O)(=O)NC[C@@H]1CC[C@@H](N)CO1.Cl |
| InChI | InChI=1S/C9H20N2O4S.ClH/c1-14-4-5-16(12,13)11-6-9-3-2-8(10)7-15-9;/h8-9,11H,2-7,10H2,1H3;1H/t8-,9+;/m1./s1 |
| InChIKey | KLJGDVGUFUBILR-RJUBDTSPSA-N |
| XLogP | -0.52 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride?
The IUPAC name of N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride (CID 164580535) is N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride.
What is the SMILES notation for N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride?
The canonical SMILES for N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride is COCCS(=O)(=O)NC[C@@H]1CC[C@@H](N)CO1.Cl.
What is the InChIKey of N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride?
The InChIKey is KLJGDVGUFUBILR-RJUBDTSPSA-N. The full InChI is InChI=1S/C9H20N2O4S.ClH/c1-14-4-5-16(12,13)11-6-9-3-2-8(10)7-15-9;/h8-9,11H,2-7,10H2,1H3;1H/t8-,9+;/m1./s1.
What are the key properties of N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride?
N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride has a molecular weight of 288.80 g/mol, XLogP of -0.52, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S,5R)-5-aminooxan-2-yl]methyl]-2-methoxyethanesulfonamide;hydrochloride is sourced from PubChem (CID 164580535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).