C16H10ClFO4 — CID 164580629
2-chloro-4-[[2-(fluoromethyl)-1-benzofuran-7-yl]oxy]benzoic acid (PubChem CID 164580629) has the molecular formula C16H10ClFO4 and a molecular weight of 320.70 g/mol. Its IUPAC name is 2-chloro-4-[[2-(fluoromethyl)-1-benzofuran-7-yl]oxy]benzoic acid.
| Compound Name | 2-chloro-4-[[2-(fluoromethyl)-1-benzofuran-7-yl]oxy]benzoic acid |
|---|---|
| PubChem CID | 164580629 |
| Molecular Formula | C16H10ClFO4 |
| Molecular Weight | 320.70 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-chloro-4-[[2-(fluoromethyl)-1-benzofuran-7-yl]oxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2cccc3cc(CF)oc23)cc1Cl |
| InChI | InChI=1S/C16H10ClFO4/c17-13-7-10(4-5-12(13)16(19)20)21-14-3-1-2-9-6-11(8-18)22-15(9)14/h1-7H,8H2,(H,19,20) |
| InChIKey | JSAUVNWXJMSENC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |