C22H25F2N7S — CID 164580794
2-[4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-4-N-[2-(dimethylamino)ethyl]-5-ethanimidoylpyrimidine-4,6-diamine (PubChem CID 164580794) has the molecular formula C22H25F2N7S and a molecular weight of 457.55 g/mol. Its IUPAC name is 2-[4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-4-N-[2-(dimethylamino)ethyl]-5-ethanimidoylpyrimidine-4,6-diamine.
| Compound Name | 2-[4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-4-N-[2-(dimethylamino)ethyl]-5-ethanimidoylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 164580794 |
| Molecular Formula | C22H25F2N7S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 2-[4-[(2,5-difluorophenyl)sulfanylamino]phenyl]-4-N-[2-(dimethylamino)ethyl]-5-ethanimidoylpyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\C)c1c(N)nc(-c2ccc(NSc3cc(F)ccc3F)cc2)nc1NCCN(C)C |
| InChI | InChI=1S/C22H25F2N7S/c1-13(25)19-20(26)28-21(29-22(19)27-10-11-31(2)3)14-4-7-16(8-5-14)30-32-18-12-15(23)6-9-17(18)24/h4-9,12,25,30H,10-11H2,1-3H3,(H3,26,27,28,29)/b25-13+ |
| InChIKey | WYTXDDPVHIVJQL-DHRITJCHSA-N |
| XLogP | 4.48 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|