About (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine
(Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine (PubChem CID 164581205) has the molecular formula C13H16N2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine.
Molecular Properties
| Compound Name | (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine |
| PubChem CID | 164581205 |
| Molecular Formula | C13H16N2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine |
| SMILES | Cc1ccc(/C(N)=C/n2sc(C)c2C)cc1 |
| InChI | InChI=1S/C13H16N2S/c1-9-4-6-12(7-5-9)13(14)8-15-10(2)11(3)16-15/h4-8H,14H2,1-3H3/b13-8- |
| InChIKey | NLTVBOZBUADMEW-JYRVWZFOSA-N |
| XLogP | 3.39 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine?
The IUPAC name of (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine (CID 164581205) is (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine.
What is the SMILES notation for (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine?
The canonical SMILES for (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine is Cc1ccc(/C(N)=C/n2sc(C)c2C)cc1.
What is the InChIKey of (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine?
The InChIKey is NLTVBOZBUADMEW-JYRVWZFOSA-N. The full InChI is InChI=1S/C13H16N2S/c1-9-4-6-12(7-5-9)13(14)8-15-10(2)11(3)16-15/h4-8H,14H2,1-3H3/b13-8-.
What are the key properties of (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine?
(Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine has a molecular weight of 232.35 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(3,4-dimethylthiazet-2-yl)-1-(4-methylphenyl)ethenamine is sourced from PubChem (CID 164581205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).