About 1H-inden-2-ol;trifluoromethanethiol
1H-inden-2-ol;trifluoromethanethiol (PubChem CID 164582111) has the molecular formula C10H9F3OS
and a molecular weight of 234.24 g/mol. Its IUPAC name is 1H-inden-2-ol;trifluoromethanethiol.
Molecular Properties
| Compound Name | 1H-inden-2-ol;trifluoromethanethiol |
| PubChem CID | 164582111 |
| Molecular Formula | C10H9F3OS |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 1H-inden-2-ol;trifluoromethanethiol |
| SMILES | FC(F)(F)S.OC1=Cc2ccccc2C1 |
| InChI | InChI=1S/C9H8O.CHF3S/c10-9-5-7-3-1-2-4-8(7)6-9;2-1(3,4)5/h1-5,10H,6H2;5H |
| InChIKey | WELGUDYDRWBFOW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-2-ol;trifluoromethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-2-ol;trifluoromethanethiol?
The IUPAC name of 1H-inden-2-ol;trifluoromethanethiol (CID 164582111) is 1H-inden-2-ol;trifluoromethanethiol.
What is the SMILES notation for 1H-inden-2-ol;trifluoromethanethiol?
The canonical SMILES for 1H-inden-2-ol;trifluoromethanethiol is FC(F)(F)S.OC1=Cc2ccccc2C1.
What is the InChIKey of 1H-inden-2-ol;trifluoromethanethiol?
The InChIKey is WELGUDYDRWBFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.CHF3S/c10-9-5-7-3-1-2-4-8(7)6-9;2-1(3,4)5/h1-5,10H,6H2;5H.
What are the key properties of 1H-inden-2-ol;trifluoromethanethiol?
1H-inden-2-ol;trifluoromethanethiol has a molecular weight of 234.24 g/mol, XLogP of 3.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-2-ol;trifluoromethanethiol is sourced from PubChem (CID 164582111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).