C21H29NOSi — CID 164583010
trimethyl-[[(2R)-1-methylpyrrolidin-2-yl]-diphenylmethoxy]silane (PubChem CID 164583010) has the molecular formula C21H29NOSi and a molecular weight of 339.56 g/mol. Its IUPAC name is trimethyl-[[(2R)-1-methylpyrrolidin-2-yl]-diphenylmethoxy]silane.
| Compound Name | trimethyl-[[(2R)-1-methylpyrrolidin-2-yl]-diphenylmethoxy]silane |
|---|---|
| PubChem CID | 164583010 |
| Molecular Formula | C21H29NOSi |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | trimethyl-[[(2R)-1-methylpyrrolidin-2-yl]-diphenylmethoxy]silane |
| SMILES | CN1CCC[C@@H]1C(O[Si](C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NOSi/c1-22-17-11-16-20(22)21(23-24(2,3)4,18-12-7-5-8-13-18)19-14-9-6-10-15-19/h5-10,12-15,20H,11,16-17H2,1-4H3/t20-/m1/s1 |
| InChIKey | OCGJROLTRVEFNJ-HXUWFJFHSA-N |
| XLogP | 4.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|