C11H14FNO — CID 164583537
(5R,8R)-5-ethyl-8-fluoro-5,6,7,8-tetrahydro-1H-quinolin-4-one (PubChem CID 164583537) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is (5R,8R)-5-ethyl-8-fluoro-5,6,7,8-tetrahydro-1H-quinolin-4-one.
| Compound Name | (5R,8R)-5-ethyl-8-fluoro-5,6,7,8-tetrahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 164583537 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (5R,8R)-5-ethyl-8-fluoro-5,6,7,8-tetrahydro-1H-quinolin-4-one |
| SMILES | CC[C@@H]1CC[C@@H](F)c2[nH]ccc(=O)c21 |
| InChI | InChI=1S/C11H14FNO/c1-2-7-3-4-8(12)11-10(7)9(14)5-6-13-11/h5-8H,2-4H2,1H3,(H,13,14)/t7-,8-/m1/s1 |
| InChIKey | RVZHFYDPVVZSPW-HTQZYQBOSA-N |
| XLogP | 2.67 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |