C14H30O3 — CID 164583787
2-[2-(2-ethoxyethoxy)ethoxy]-2,4,4-trimethylpentane (PubChem CID 164583787) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethoxy]-2,4,4-trimethylpentane.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethoxy]-2,4,4-trimethylpentane |
|---|---|
| PubChem CID | 164583787 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethoxy]-2,4,4-trimethylpentane |
| SMILES | CCOCCOCCOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H30O3/c1-7-15-8-9-16-10-11-17-14(5,6)12-13(2,3)4/h7-12H2,1-6H3 |
| InChIKey | AFLMMZANQZYQJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|