C22H19F3N4O6 — CID 164584109
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-methyl-5-(trifluoromethoxy)-3-pyridinyl]carbamate (PubChem CID 164584109) has the molecular formula C22H19F3N4O6 and a molecular weight of 492.41 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-methyl-5-(trifluoromethoxy)-3-pyridinyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-methyl-5-(trifluoromethoxy)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164584109 |
| Molecular Formula | C22H19F3N4O6 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-methyl-5-(trifluoromethoxy)-3-pyridinyl]carbamate |
| SMILES | Cc1ncc(NC(=O)OCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1OC(F)(F)F |
| InChI | InChI=1S/C22H19F3N4O6/c1-11-17(35-22(23,24)25)7-14(8-26-11)27-21(33)34-10-12-2-3-13-9-29(20(32)15(13)6-12)16-4-5-18(30)28-19(16)31/h2-3,6-8,16H,4-5,9-10H2,1H3,(H,27,33)(H,28,30,31) |
| InChIKey | GOVLUHXMVBQFDQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|