C25H27N5O5 — CID 164584133
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-[(2S)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate (PubChem CID 164584133) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-[(2S)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-[(2S)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164584133 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-[(2S)-2-methylpyrrolidin-1-yl]-3-pyridinyl]carbamate |
| SMILES | C[C@H]1CCCN1c1ccc(NC(=O)OCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cn1 |
| InChI | InChI=1S/C25H27N5O5/c1-15-3-2-10-29(15)21-8-6-18(12-26-21)27-25(34)35-14-16-4-5-17-13-30(24(33)19(17)11-16)20-7-9-22(31)28-23(20)32/h4-6,8,11-12,15,20H,2-3,7,9-10,13-14H2,1H3,(H,27,34)(H,28,31,32)/t15-,20?/m0/s1 |
| InChIKey | HUPQGYWOOXXMSL-OOJLDXBWSA-N |
| XLogP | 2.58 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|