C25H26FN5O5 — CID 164584135
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(5-fluoro-6-piperidin-1-yl-3-pyridinyl)carbamate (PubChem CID 164584135) has the molecular formula C25H26FN5O5 and a molecular weight of 495.51 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(5-fluoro-6-piperidin-1-yl-3-pyridinyl)carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(5-fluoro-6-piperidin-1-yl-3-pyridinyl)carbamate |
|---|---|
| PubChem CID | 164584135 |
| Molecular Formula | C25H26FN5O5 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-(5-fluoro-6-piperidin-1-yl-3-pyridinyl)carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)Nc4cnc(N5CCCCC5)c(F)c4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H26FN5O5/c26-19-11-17(12-27-22(19)30-8-2-1-3-9-30)28-25(35)36-14-15-4-5-16-13-31(24(34)18(16)10-15)20-6-7-21(32)29-23(20)33/h4-5,10-12,20H,1-3,6-9,13-14H2,(H,28,35)(H,29,32,33) |
| InChIKey | ASANYZRQUPXXDD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|