About N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine
N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine (PubChem CID 164584215) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine |
| PubChem CID | 164584215 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine |
| SMILES | CNc1cnc2c(c1)COCC2 |
| InChI | InChI=1S/C9H12N2O/c1-10-8-4-7-6-12-3-2-9(7)11-5-8/h4-5,10H,2-3,6H2,1H3 |
| InChIKey | MWHSWWCDWNGFTH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
The IUPAC name of N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine (CID 164584215) is N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine.
What is the SMILES notation for N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
The canonical SMILES for N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine is CNc1cnc2c(c1)COCC2.
What is the InChIKey of N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
The InChIKey is MWHSWWCDWNGFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-10-8-4-7-6-12-3-2-9(7)11-5-8/h4-5,10H,2-3,6H2,1H3.
What are the key properties of N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine has a molecular weight of 164.21 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine is sourced from PubChem (CID 164584215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).