C25H25F2N5O5 — CID 164584354
[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-(3,3-difluoropiperidin-1-yl)-3-pyridinyl]carbamate (PubChem CID 164584354) has the molecular formula C25H25F2N5O5 and a molecular weight of 513.50 g/mol. Its IUPAC name is [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-(3,3-difluoropiperidin-1-yl)-3-pyridinyl]carbamate.
| Compound Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-(3,3-difluoropiperidin-1-yl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164584354 |
| Molecular Formula | C25H25F2N5O5 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | [2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]methyl N-[6-(3,3-difluoropiperidin-1-yl)-3-pyridinyl]carbamate |
| SMILES | O=C1CCC(N2Cc3ccc(COC(=O)Nc4ccc(N5CCCC(F)(F)C5)nc4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H25F2N5O5/c26-25(27)8-1-9-31(14-25)20-6-4-17(11-28-20)29-24(36)37-13-15-2-3-16-12-32(23(35)18(16)10-15)19-5-7-21(33)30-22(19)34/h2-4,6,10-11,19H,1,5,7-9,12-14H2,(H,29,36)(H,30,33,34) |
| InChIKey | YGXJUGFKVBAQDE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|