About (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane
(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane (PubChem CID 164584456) has the molecular formula C18H29NOSi
and a molecular weight of 303.52 g/mol. Its IUPAC name is (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane.
Molecular Properties
| Compound Name | (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane |
| PubChem CID | 164584456 |
| Molecular Formula | C18H29NOSi |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC1=CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H29NOSi/c1-4-21(5-2,6-3)20-18-12-14-19(15-13-18)16-17-10-8-7-9-11-17/h7-12H,4-6,13-16H2,1-3H3 |
| InChIKey | YLXFNUSHYHZICF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane?
The IUPAC name of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane (CID 164584456) is (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane.
What is the SMILES notation for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane?
The canonical SMILES for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane is CC[Si](CC)(CC)OC1=CCN(Cc2ccccc2)CC1.
What is the InChIKey of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane?
The InChIKey is YLXFNUSHYHZICF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NOSi/c1-4-21(5-2,6-3)20-18-12-14-19(15-13-18)16-17-10-8-7-9-11-17/h7-12H,4-6,13-16H2,1-3H3.
What are the key properties of (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane?
(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane has a molecular weight of 303.52 g/mol, XLogP of 4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-benzyl-3,6-dihydro-2H-pyridin-4-yl)oxy-triethylsilane is sourced from PubChem (CID 164584456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).