About 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one
1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one (PubChem CID 164584726) has the molecular formula C13H16F3NO
and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one.
Molecular Properties
| Compound Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one |
| PubChem CID | 164584726 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one |
| SMILES | C=C/C=C(\C=C)CN1CCC(=O)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H16F3NO/c1-3-5-10(4-2)8-17-7-6-12(18)11(9-17)13(14,15)16/h3-5,11H,1-2,6-9H2/b10-5+ |
| InChIKey | GXBCJWCEIGSMJA-BJMVGYQFSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one?
The IUPAC name of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one (CID 164584726) is 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one.
What is the SMILES notation for 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one?
The canonical SMILES for 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one is C=C/C=C(\C=C)CN1CCC(=O)C(C(F)(F)F)C1.
What is the InChIKey of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one?
The InChIKey is GXBCJWCEIGSMJA-BJMVGYQFSA-N. The full InChI is InChI=1S/C13H16F3NO/c1-3-5-10(4-2)8-17-7-6-12(18)11(9-17)13(14,15)16/h3-5,11H,1-2,6-9H2/b10-5+.
What are the key properties of 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one?
1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one has a molecular weight of 259.27 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-2-ethenylpenta-2,4-dienyl]-3-(trifluoromethyl)piperidin-4-one is sourced from PubChem (CID 164584726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).