About CID 164584881
CID 164584881 (PubChem CID 164584881) has the molecular formula C17H19N2Po
and a molecular weight of 460.35 g/mol.
Molecular Properties
| Compound Name | CID 164584881 |
| PubChem CID | 164584881 |
| Molecular Formula | C17H19N2Po |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | — |
| SMILES | C[Po].Cc1ccc(/N=C/C=N/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H16N2.CH3.Po/c1-13-3-7-15(8-4-13)17-11-12-18-16-9-5-14(2)6-10-16;;/h3-12H,1-2H3;1H3;/b17-11+,18-12+;; |
| InChIKey | PCOYMHKBIXEMCK-SNTCFBDDSA-N |
| XLogP | 4.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164584881 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164584881?
The IUPAC name of CID 164584881 (CID 164584881) is not available.
What is the SMILES notation for CID 164584881?
The canonical SMILES for CID 164584881 is C[Po].Cc1ccc(/N=C/C=N/c2ccc(C)cc2)cc1.
What is the InChIKey of CID 164584881?
The InChIKey is PCOYMHKBIXEMCK-SNTCFBDDSA-N. The full InChI is InChI=1S/C16H16N2.CH3.Po/c1-13-3-7-15(8-4-13)17-11-12-18-16-9-5-14(2)6-10-16;;/h3-12H,1-2H3;1H3;/b17-11+,18-12+;;.
What are the key properties of CID 164584881?
CID 164584881 has a molecular weight of 460.35 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164584881 is sourced from PubChem (CID 164584881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).