C21H19Cl2N5O — CID 164585990
11-(2,6-dichlorophenyl)-13-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one (PubChem CID 164585990) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is 11-(2,6-dichlorophenyl)-13-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one.
| Compound Name | 11-(2,6-dichlorophenyl)-13-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
|---|---|
| PubChem CID | 164585990 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 11-(2,6-dichlorophenyl)-13-methyl-4-(1,2,3,6-tetrahydropyridin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-10-one |
| SMILES | CN1CN(c2c(Cl)cccc2Cl)C(=O)c2cnc3[nH]c(C4=CCNCC4)cc3c21 |
| InChI | InChI=1S/C21H19Cl2N5O/c1-27-11-28(19-15(22)3-2-4-16(19)23)21(29)14-10-25-20-13(18(14)27)9-17(26-20)12-5-7-24-8-6-12/h2-5,9-10,24H,6-8,11H2,1H3,(H,25,26) |
| InChIKey | KLIHBXBTJNZKCZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |