C23H31NO6 — CID 164586142
18-O-tert-butyl 5-O-methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5,18-dicarboxylate (PubChem CID 164586142) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is 18-O-tert-butyl 5-O-methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5,18-dicarboxylate.
| Compound Name | 18-O-tert-butyl 5-O-methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5,18-dicarboxylate |
|---|---|
| PubChem CID | 164586142 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 18-O-tert-butyl 5-O-methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5,18-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1)OCC/C=C\CO[C@H]1CCN(C(=O)OC(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C23H31NO6/c1-23(2,3)30-22(26)24-11-10-17-15-19(24)18-9-8-16(21(25)27-4)14-20(18)29-13-7-5-6-12-28-17/h5-6,8-9,14,17,19H,7,10-13,15H2,1-4H3/b6-5-/t17-,19-/m0/s1 |
| InChIKey | CIUCLBFYKUSYGK-HGFKVBKKSA-N |
| XLogP | 4.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|