C22H39NO3 — CID 164586391
tert-butyl (2S,4S)-4-heptoxy-2-[(3Z)-penta-1,3-dien-2-yl]piperidine-1-carboxylate (PubChem CID 164586391) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-heptoxy-2-[(3Z)-penta-1,3-dien-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-heptoxy-2-[(3Z)-penta-1,3-dien-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 164586391 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | tert-butyl (2S,4S)-4-heptoxy-2-[(3Z)-penta-1,3-dien-2-yl]piperidine-1-carboxylate |
| SMILES | C=C(/C=C\C)[C@@H]1C[C@@H](OCCCCCCC)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39NO3/c1-7-9-10-11-12-16-25-19-14-15-23(21(24)26-22(4,5)6)20(17-19)18(3)13-8-2/h8,13,19-20H,3,7,9-12,14-17H2,1-2,4-6H3/b13-8-/t19-,20-/m0/s1 |
| InChIKey | LXFFTJNZMRVGMC-LMEYLOCPSA-N |
| XLogP | 5.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|