C22H25NO4 — CID 164586411
methyl (2S,6S,9E)-7,13-dioxa-3-azatetracyclo[12.6.2.12,6.017,21]tricosa-1(21),9,14(22),15,17,19-hexaene-18-carboxylate (PubChem CID 164586411) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl (2S,6S,9E)-7,13-dioxa-3-azatetracyclo[12.6.2.12,6.017,21]tricosa-1(21),9,14(22),15,17,19-hexaene-18-carboxylate.
| Compound Name | methyl (2S,6S,9E)-7,13-dioxa-3-azatetracyclo[12.6.2.12,6.017,21]tricosa-1(21),9,14(22),15,17,19-hexaene-18-carboxylate |
|---|---|
| PubChem CID | 164586411 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | methyl (2S,6S,9E)-7,13-dioxa-3-azatetracyclo[12.6.2.12,6.017,21]tricosa-1(21),9,14(22),15,17,19-hexaene-18-carboxylate |
| SMILES | COC(=O)c1ccc2c3cc(ccc13)OCC/C=C/CO[C@H]1CCN[C@H]2C1 |
| InChI | InChI=1S/C22H25NO4/c1-25-22(24)19-8-7-18-20-13-15(5-6-17(19)20)26-11-3-2-4-12-27-16-9-10-23-21(18)14-16/h2,4-8,13,16,21,23H,3,9-12,14H2,1H3/b4-2+/t16-,21-/m0/s1 |
| InChIKey | HVVGFBKGSHEPSV-KIAIIABPSA-N |
| XLogP | 3.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|