C12H8ClF3N2O2 — CID 164586851
(2-chloro-3-cyano-5,6,7,8-tetrahydroquinolin-8-yl) 2,2,2-trifluoroacetate (PubChem CID 164586851) has the molecular formula C12H8ClF3N2O2 and a molecular weight of 304.66 g/mol. Its IUPAC name is (2-chloro-3-cyano-5,6,7,8-tetrahydroquinolin-8-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2-chloro-3-cyano-5,6,7,8-tetrahydroquinolin-8-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 164586851 |
| Molecular Formula | C12H8ClF3N2O2 |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (2-chloro-3-cyano-5,6,7,8-tetrahydroquinolin-8-yl) 2,2,2-trifluoroacetate |
| SMILES | N#Cc1cc2c(nc1Cl)C(OC(=O)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C12H8ClF3N2O2/c13-10-7(5-17)4-6-2-1-3-8(9(6)18-10)20-11(19)12(14,15)16/h4,8H,1-3H2 |
| InChIKey | FCHQEYPCXLDDSH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|