C11H15N2O+ — CID 164586966
1-hydroxy-7-methyl-3,4,5,6,7,8-hexahydroquinolin-1-ium-3-carbonitrile (PubChem CID 164586966) has the molecular formula C11H15N2O+ and a molecular weight of 191.25 g/mol. Its IUPAC name is 1-hydroxy-7-methyl-3,4,5,6,7,8-hexahydroquinolin-1-ium-3-carbonitrile.
| Compound Name | 1-hydroxy-7-methyl-3,4,5,6,7,8-hexahydroquinolin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 164586966 |
| Molecular Formula | C11H15N2O+ |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1-hydroxy-7-methyl-3,4,5,6,7,8-hexahydroquinolin-1-ium-3-carbonitrile |
| SMILES | CC1CCC2=C(C1)[N+](O)=CC(C#N)C2 |
| InChI | InChI=1S/C11H15N2O/c1-8-2-3-10-5-9(6-12)7-13(14)11(10)4-8/h7-9,14H,2-5H2,1H3/q+1 |
| InChIKey | NBFRJHSPQMQLOW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|