C12H13N — CID 164587220
3-ethynyl-4-methyl-5,6,7,8-tetrahydroquinoline (PubChem CID 164587220) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-ethynyl-4-methyl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 3-ethynyl-4-methyl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 164587220 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-ethynyl-4-methyl-5,6,7,8-tetrahydroquinoline |
| SMILES | C#Cc1cnc2c(c1C)CCCC2 |
| InChI | InChI=1S/C12H13N/c1-3-10-8-13-12-7-5-4-6-11(12)9(10)2/h1,8H,4-7H2,2H3 |
| InChIKey | ZYVOGSUOEBATCW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|