C18H12ClN7O — CID 164587264
2-chloro-5-cyano-N-[1-(1-methylpyrazol-4-yl)indazol-6-yl]pyridine-3-carboxamide (PubChem CID 164587264) has the molecular formula C18H12ClN7O and a molecular weight of 377.80 g/mol. Its IUPAC name is 2-chloro-5-cyano-N-[1-(1-methylpyrazol-4-yl)indazol-6-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-cyano-N-[1-(1-methylpyrazol-4-yl)indazol-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164587264 |
| Molecular Formula | C18H12ClN7O |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-chloro-5-cyano-N-[1-(1-methylpyrazol-4-yl)indazol-6-yl]pyridine-3-carboxamide |
| SMILES | Cn1cc(-n2ncc3ccc(NC(=O)c4cc(C#N)cnc4Cl)cc32)cn1 |
| InChI | InChI=1S/C18H12ClN7O/c1-25-10-14(9-22-25)26-16-5-13(3-2-12(16)8-23-26)24-18(27)15-4-11(6-20)7-21-17(15)19/h2-5,7-10H,1H3,(H,24,27) |
| InChIKey | TUOXUWSVDIKEPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|