About [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol
[2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol (PubChem CID 164587602) has the molecular formula C17H16FN3O4S2
and a molecular weight of 409.46 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 164587602 |
| Molecular Formula | C17H16FN3O4S2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol |
| SMILES | COc1cc(-c2nc(Nc3ccc(S(C)(=O)=O)c(F)c3)sc2CO)ccn1 |
| InChI | InChI=1S/C17H16FN3O4S2/c1-25-15-7-10(5-6-19-15)16-13(9-22)26-17(21-16)20-11-3-4-14(12(18)8-11)27(2,23)24/h3-8,22H,9H2,1-2H3,(H,20,21) |
| InChIKey | AMTDJRCYYRGGIK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol (CID 164587602) is [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol is COc1cc(-c2nc(Nc3ccc(S(C)(=O)=O)c(F)c3)sc2CO)ccn1.
What is the InChIKey of [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol?
The InChIKey is AMTDJRCYYRGGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O4S2/c1-25-15-7-10(5-6-19-15)16-13(9-22)26-17(21-16)20-11-3-4-14(12(18)8-11)27(2,23)24/h3-8,22H,9H2,1-2H3,(H,20,21).
What are the key properties of [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol?
[2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol has a molecular weight of 409.46 g/mol, XLogP of 2.99, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-fluoro-4-methylsulfonylanilino)-4-(2-methoxy-4-pyridinyl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 164587602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).